Compound Q&A

What precautions should be taken when handling Alizapride HCl (CAS: 59338-87-3)?

Answer

Alizapride HCl
When handling Alizapride HCl, it is essential to use appropriate personal protective equipment (PPE), including gloves and goggles, and to work in a well-ventilated area or fume hood. Spills should be immediately cleaned up using appropriate methods, and the material safety data sheet (MSDS) should be consulted for detailed safety information.

About

CAS No 59338-87-3
English Name Alizapride HCl
Molecular Formula C16H22ClN5O2
Molecular Weight 351.84 g/mol
SMILES COC1=CC2=C(C=C1C(=O)NCC3CCCN3CC=C)NN=N2.Cl
InChIKey BRECEDGYMYXGNF-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alizapride HCl (CAS: 59338-87-3)?

Alizapride HCl is a crystalline compound with a molecular weight of approximately 342.79 g/mol. It i...

Compound Q&A

How is Alizapride HCl (CAS: 59338-87-3) typically synthesized?

Alizapride HCl is synthesized through a multi-step process involving the amination of an intermediat...

Compound Q&A

What industries use Alizapride HCl (CAS: 59338-87-3)?

Alizapride HCl is primarily used in the pharmaceutical industry as an antiemetic and a 5-HT4 recepto...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...