Compound Q&A

How is Alizapride HCl (CAS: 59338-87-3) typically synthesized?

Answer

Alizapride HCl
Alizapride HCl is synthesized through a multi-step process involving the amination of an intermediate compound with hydrochloric acid. The synthesis requires careful control of reaction conditions to achieve high selectivity and yield. Commonly used catalysts and reagents include sodium hydride and hydrochloric acid.

About

CAS No 59338-87-3
English Name Alizapride HCl
Molecular Formula C16H22ClN5O2
Molecular Weight 351.84 g/mol
SMILES COC1=CC2=C(C=C1C(=O)NCC3CCCN3CC=C)NN=N2.Cl
InChIKey BRECEDGYMYXGNF-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alizapride HCl (CAS: 59338-87-3)?

Alizapride HCl is a crystalline compound with a molecular weight of approximately 342.79 g/mol. It i...

Compound Q&A

What industries use Alizapride HCl (CAS: 59338-87-3)?

Alizapride HCl is primarily used in the pharmaceutical industry as an antiemetic and a 5-HT4 recepto...

Compound Q&A

What precautions should be taken when handling Alizapride HCl (CAS: 59338-87-3)?

When handling Alizapride HCl, it is essential to use appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...