Compound Q&A

What are the physical and chemical properties of Alizapride HCl (CAS: 59338-87-3)?

Answer

Alizapride HCl
Alizapride HCl is a crystalline compound with a molecular weight of approximately 342.79 g/mol. It is sparingly soluble in water and ethanol. Chemically, it is a selective 5-HT4 receptor antagonist. It is stable under normal storage conditions but should be protected from moisture and light.

About

CAS No 59338-87-3
English Name Alizapride HCl
Molecular Formula C16H22ClN5O2
Molecular Weight 351.84 g/mol
SMILES COC1=CC2=C(C=C1C(=O)NCC3CCCN3CC=C)NN=N2.Cl
InChIKey BRECEDGYMYXGNF-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is Alizapride HCl (CAS: 59338-87-3) typically synthesized?

Alizapride HCl is synthesized through a multi-step process involving the amination of an intermediat...

Compound Q&A

What industries use Alizapride HCl (CAS: 59338-87-3)?

Alizapride HCl is primarily used in the pharmaceutical industry as an antiemetic and a 5-HT4 recepto...

Compound Q&A

What precautions should be taken when handling Alizapride HCl (CAS: 59338-87-3)?

When handling Alizapride HCl, it is essential to use appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...