Compound Q&A

What industries use 2-Nitrobenzenesulfonamide (CAS: 5455-59-4)?

Answer

2-Nitrobenzenesulfonamide
2-Nitrobenzenesulfonamide (CAS: 5455-59-4) is primarily used in the pharmaceutical industry for the synthesis of various drugs and intermediates. It is also used in the polymer industry for the preparation of functionalized polymers. Additionally, it has applications in the sensor industry for the development of chemical sensors and in the semiconductor industry as a dopant.

About

CAS No 5455-59-4
English Name 2-Nitrobenzenesulfonamide
Molecular Formula C6H6N2O4S
Molecular Weight 202.19 g/mol
SMILES C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)N
InChIKey GNDKYAWHEKZHPJ-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitrobenzenesulfonamide (CAS: 5455-59-4)?

2-Nitrobenzenesulfonamide (CAS: 5455-59-4) is a white crystalline solid with a molecular weight of 2...

Compound Q&A

How is 2-Nitrobenzenesulfonamide (CAS: 5455-59-4) typically synthesized?

2-Nitrobenzenesulfonamide (CAS: 5455-59-4) is usually synthesized by the reaction of 2-nitrobenzenes...

Compound Q&A

What precautions should be taken when handling 2-Nitrobenzenesulfonamide (CAS: 5455-59-4)?

When handling 2-Nitrobenzenesulfonamide (CAS: 5455-59-4), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...