Compound Q&A

What are the physical and chemical properties of 2-Nitrobenzenesulfonamide (CAS: 5455-59-4)?

Answer

2-Nitrobenzenesulfonamide
2-Nitrobenzenesulfonamide (CAS: 5455-59-4) is a white crystalline solid with a molecular weight of 217.09 g/mol. It has a melting point of 155-157°C and is slightly soluble in water. It exhibits good solubility in common organic solvents like methanol, ethanol, and acetone. This compound is chemically stable but can react with strong bases to form 2-amino-5-nitrobenzenesulfonate. It is used as a reagent in organic synthesis and pharmaceutical industry.

About

CAS No 5455-59-4
English Name 2-Nitrobenzenesulfonamide
Molecular Formula C6H6N2O4S
Molecular Weight 202.19 g/mol
SMILES C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)N
InChIKey GNDKYAWHEKZHPJ-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is 2-Nitrobenzenesulfonamide (CAS: 5455-59-4) typically synthesized?

2-Nitrobenzenesulfonamide (CAS: 5455-59-4) is usually synthesized by the reaction of 2-nitrobenzenes...

Compound Q&A

What industries use 2-Nitrobenzenesulfonamide (CAS: 5455-59-4)?

2-Nitrobenzenesulfonamide (CAS: 5455-59-4) is primarily used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling 2-Nitrobenzenesulfonamide (CAS: 5455-59-4)?

When handling 2-Nitrobenzenesulfonamide (CAS: 5455-59-4), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...