Compound Q&A

How is 2-Nitrobenzenesulfonamide (CAS: 5455-59-4) typically synthesized?

Answer

2-Nitrobenzenesulfonamide
2-Nitrobenzenesulfonamide (CAS: 5455-59-4) is usually synthesized by the reaction of 2-nitrobenzenesulfonyl chloride with ammonia in the presence of a catalyst such as sodium hydroxide. This process involves the nucleophilic attack of ammonia on the sulfonyl chloride group, followed by work-up to obtain the desired amide. The yield and selectivity are typically very good, with high purity products being obtained.

About

CAS No 5455-59-4
English Name 2-Nitrobenzenesulfonamide
Molecular Formula C6H6N2O4S
Molecular Weight 202.19 g/mol
SMILES C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)N
InChIKey GNDKYAWHEKZHPJ-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitrobenzenesulfonamide (CAS: 5455-59-4)?

2-Nitrobenzenesulfonamide (CAS: 5455-59-4) is a white crystalline solid with a molecular weight of 2...

Compound Q&A

What industries use 2-Nitrobenzenesulfonamide (CAS: 5455-59-4)?

2-Nitrobenzenesulfonamide (CAS: 5455-59-4) is primarily used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling 2-Nitrobenzenesulfonamide (CAS: 5455-59-4)?

When handling 2-Nitrobenzenesulfonamide (CAS: 5455-59-4), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...