Compound Q&A

What precautions should be taken when handling N,N'-Diphenylimidoformamide (CAS: 622-15-1)?

Answer

N,N'-Diphenylimidoformamide
When handling N,N'-Diphenylimidoformamide (CAS: 622-15-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety glasses, and a lab coat to prevent skin and eye contact. The compound should be handled in a well-ventilated fume hood to minimize inhalation risks. In case of a spill, it should be immediately cleaned up using appropriate absorbents, and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 622-15-1
English Name N,N'-Diphenylimidoformamide
Molecular Formula C13H12N2
Molecular Weight 196.25 g/mol
EINECS 210-720-9
SMILES C1=CC=C(C=C1)NC=NC2=CC=CC=C2
InChIKey ZQUVDXMUKIVNOW-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-Diphenylimidoformamide (CAS: 622-15-1)?

N,N'-Diphenylimidoformamide (CAS: 622-15-1) is a crystalline compound with a molecular weight of app...

Compound Q&A

How is N,N'-Diphenylimidoformamide (CAS: 622-15-1) typically synthesized?

N,N'-Diphenylimidoformamide is typically synthesized by the reaction of phthalimide with anhydrous a...

Compound Q&A

What industries use N,N'-Diphenylimidoformamide (CAS: 622-15-1)?

N,N'-Diphenylimidoformamide (CAS: 622-15-1) is primarily used in the pharmaceutical industry for the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...