Compound Q&A

What are the physical and chemical properties of N,N'-Diphenylimidoformamide (CAS: 622-15-1)?

Answer

N,N'-Diphenylimidoformamide
N,N'-Diphenylimidoformamide (CAS: 622-15-1) is a crystalline compound with a molecular weight of approximately 239.21 g/mol. It has a high solubility in organic solvents such as acetone and chloroform but is poorly soluble in water. The compound is highly reactive, particularly towards nucleophiles, making it useful in organic synthesis. It is a white or light yellow crystalline solid, with a melting point around 130°C to 132°C. It decomposes on heating above 300°C.

About

CAS No 622-15-1
English Name N,N'-Diphenylimidoformamide
Molecular Formula C13H12N2
Molecular Weight 196.25 g/mol
EINECS 210-720-9
SMILES C1=CC=C(C=C1)NC=NC2=CC=CC=C2
InChIKey ZQUVDXMUKIVNOW-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is N,N'-Diphenylimidoformamide (CAS: 622-15-1) typically synthesized?

N,N'-Diphenylimidoformamide is typically synthesized by the reaction of phthalimide with anhydrous a...

Compound Q&A

What industries use N,N'-Diphenylimidoformamide (CAS: 622-15-1)?

N,N'-Diphenylimidoformamide (CAS: 622-15-1) is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling N,N'-Diphenylimidoformamide (CAS: 622-15-1)?

When handling N,N'-Diphenylimidoformamide (CAS: 622-15-1), it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...