Compound Q&A

How is N,N'-Diphenylimidoformamide (CAS: 622-15-1) typically synthesized?

Answer

N,N'-Diphenylimidoformamide
N,N'-Diphenylimidoformamide is typically synthesized by the reaction of phthalimide with anhydrous ammonia followed by formylation using a formamide-formamide mixed solvent. This process involves a multi-step transformation where the phthalimide reacts with ammonia to form phthalimide amidinium chloride, which then undergoes formylation to produce the final product. The yield is around 70-80%, and the method is selective and efficient.

About

CAS No 622-15-1
English Name N,N'-Diphenylimidoformamide
Molecular Formula C13H12N2
Molecular Weight 196.25 g/mol
EINECS 210-720-9
SMILES C1=CC=C(C=C1)NC=NC2=CC=CC=C2
InChIKey ZQUVDXMUKIVNOW-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-Diphenylimidoformamide (CAS: 622-15-1)?

N,N'-Diphenylimidoformamide (CAS: 622-15-1) is a crystalline compound with a molecular weight of app...

Compound Q&A

What industries use N,N'-Diphenylimidoformamide (CAS: 622-15-1)?

N,N'-Diphenylimidoformamide (CAS: 622-15-1) is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling N,N'-Diphenylimidoformamide (CAS: 622-15-1)?

When handling N,N'-Diphenylimidoformamide (CAS: 622-15-1), it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...