Compound Q&A

What precautions should be taken when handling 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6)?

Answer

4-Methyl-3-(trifluoromethyl)benzoic acid
When handling 4-Methyl-3-(trifluoromethyl)benzoic acid, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. It should be stored in a fume hood to minimize exposure. Spills should be cleaned up using appropriate safety procedures and materials. Always refer to the safety data sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 4-Methyl-3-(trifluoromethyl)benzoic acid
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES CC1=C(C=C(C=C1)C(=O)O)C(F)(F)F
InChIKey CAPKAYDTKWGFQB-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6)?

4-Methyl-3-(trifluoromethyl)benzoic acid is a solid with a crystalline form. It has a molecular weig...

Compound Q&A

How is 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6) typically synthesized?

4-Methyl-3-(trifluoromethyl)benzoic acid can be synthesized through the Friedel-Crafts alkylation of...

Compound Q&A

What industries use 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6)?

4-Methyl-3-(trifluoromethyl)benzoic acid is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...