Compound Q&A

What are the physical and chemical properties of 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6)?

Answer

4-Methyl-3-(trifluoromethyl)benzoic acid
4-Methyl-3-(trifluoromethyl)benzoic acid is a solid with a crystalline form. It has a molecular weight of 228.11 g/mol. This compound is poorly soluble in water but soluble in organic solvents like acetone and dichloromethane. It is reactive and can undergo typical carboxylic acid reactions such as esterification and acylation.

About

English Name 4-Methyl-3-(trifluoromethyl)benzoic acid
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES CC1=C(C=C(C=C1)C(=O)O)C(F)(F)F
InChIKey CAPKAYDTKWGFQB-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6) typically synthesized?

4-Methyl-3-(trifluoromethyl)benzoic acid can be synthesized through the Friedel-Crafts alkylation of...

Compound Q&A

What industries use 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6)?

4-Methyl-3-(trifluoromethyl)benzoic acid is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6)?

When handling 4-Methyl-3-(trifluoromethyl)benzoic acid, appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...