Compound Q&A

What industries use 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6)?

Answer

4-Methyl-3-(trifluoromethyl)benzoic acid
4-Methyl-3-(trifluoromethyl)benzoic acid is used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also used in the polymer industry as a monomer for specialty polymers. Additionally, it has applications in the electronics industry, particularly in the production of thin-film transistors and other semiconductor devices.

About

English Name 4-Methyl-3-(trifluoromethyl)benzoic acid
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES CC1=C(C=C(C=C1)C(=O)O)C(F)(F)F
InChIKey CAPKAYDTKWGFQB-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6)?

4-Methyl-3-(trifluoromethyl)benzoic acid is a solid with a crystalline form. It has a molecular weig...

Compound Q&A

How is 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6) typically synthesized?

4-Methyl-3-(trifluoromethyl)benzoic acid can be synthesized through the Friedel-Crafts alkylation of...

Compound Q&A

What precautions should be taken when handling 4-Methyl-3-(trifluoromethyl)benzoic acid (CAS: 261952-01-6)?

When handling 4-Methyl-3-(trifluoromethyl)benzoic acid, appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...