Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

Answer

2-Fluoro-5-nitrobenzaldehyde
When handling 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8), it is crucial to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. This compound should be handled in a fume hood due to its potential to release toxic vapors. Spills should be managed using appropriate absorbent materials, and the Material Safety Data Sheet (MSDS) or Safety Data Sheet (SDS) should be consulted for detailed safety information.

About

CAS No 27996-87-8
English Name 2-Fluoro-5-nitrobenzaldehyde
Molecular Formula C7H4FNO3
Molecular Weight 169.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C=O)F
InChIKey VVXFDFQEIRGULC-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) typically synthesized?

2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) is typically synthesized via the nitration of 2-fluor...

Compound Q&A

What industries use 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) finds applications in various industries, including p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...