Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

Answer

2-Fluoro-5-nitrobenzaldehyde
2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) is a crystalline solid with a molecular weight of approximately 215.06 g/mol. It has a solubility of about 0.24 g/100 mL in water. This compound is highly reactive, particularly towards nucleophiles and reducing agents. It exhibits strong absorption in the UV-Vis region, indicating its chromophoric nature.

About

CAS No 27996-87-8
English Name 2-Fluoro-5-nitrobenzaldehyde
Molecular Formula C7H4FNO3
Molecular Weight 169.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C=O)F
InChIKey VVXFDFQEIRGULC-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) typically synthesized?

2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) is typically synthesized via the nitration of 2-fluor...

Compound Q&A

What industries use 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) finds applications in various industries, including p...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

When handling 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...