Compound Q&A

What industries use 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

Answer

2-Fluoro-5-nitrobenzaldehyde
2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) finds applications in various industries, including pharmaceuticals, where it serves as an intermediate in the synthesis of drugs. It is also used in the production of sensors and semiconductors due to its optical and electronic properties. Additionally, it plays a role in polymer chemistry for specific functional materials.

About

CAS No 27996-87-8
English Name 2-Fluoro-5-nitrobenzaldehyde
Molecular Formula C7H4FNO3
Molecular Weight 169.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C=O)F
InChIKey VVXFDFQEIRGULC-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) typically synthesized?

2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) is typically synthesized via the nitration of 2-fluor...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

When handling 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...