Compound Q&A

How is 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) typically synthesized?

Answer

2-Fluoro-5-nitrobenzaldehyde
2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) is typically synthesized via the nitration of 2-fluorobenzaldehyde followed by selective reduction of the nitro group. This process often involves the use of concentrated nitric acid and sulfuric acid as nitration reagents. The reduction can be achieved using iron in hydrochloric acid, yielding the desired aldehyde.

About

CAS No 27996-87-8
English Name 2-Fluoro-5-nitrobenzaldehyde
Molecular Formula C7H4FNO3
Molecular Weight 169.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C=O)F
InChIKey VVXFDFQEIRGULC-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8) finds applications in various industries, including p...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8)?

When handling 2-Fluoro-5-nitrobenzaldehyde (CAS: 27996-87-8), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...