Compound Q&A

What precautions should be taken when handling Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5)?

Answer

Fmoc-lys(ME,boc)-OH
When handling Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5), it is important to use appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. This compound should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. In case of a spill, it is crucial to clean up the area immediately using appropriate absorbent materials and to follow the safety data sheet (SDS) for disposal instructions. Always refer to the SDS for detailed safety information and emergency procedures.

About

English Name Fmoc-lys(ME,boc)-OH
Molecular Formula C27H34N2O6
Molecular Weight 482.58 g/mol
SMILES CC(C)(C)OC(=O)N(C)CCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey JHMSFOFHTAYQLS-QHCPKHFHSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5)?

Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5) is a solid crystalline compound with a molecular weight of ap...

Compound Q&A

How is Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5) typically synthesized?

Fmoc-lys(ME,boc)-OH is typically synthesized through a multi-step process involving the protection o...

Compound Q&A

What industries use Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5)?

Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5) is primarily used in the pharmaceutical and biotechnology ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...