Compound Q&A

What industries use Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5)?

Answer

Fmoc-lys(ME,boc)-OH
Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5) is primarily used in the pharmaceutical and biotechnology industries for the synthesis of custom peptides and proteins. It is also utilized in the polymer industry for the development of functional polymers and in the semiconductor industry for the preparation of organic semiconductor materials. Additionally, this compound is used in the production of sensors and other advanced materials.

About

English Name Fmoc-lys(ME,boc)-OH
Molecular Formula C27H34N2O6
Molecular Weight 482.58 g/mol
SMILES CC(C)(C)OC(=O)N(C)CCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey JHMSFOFHTAYQLS-QHCPKHFHSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5)?

Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5) is a solid crystalline compound with a molecular weight of ap...

Compound Q&A

How is Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5) typically synthesized?

Fmoc-lys(ME,boc)-OH is typically synthesized through a multi-step process involving the protection o...

Compound Q&A

What precautions should be taken when handling Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5)?

When handling Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5), it is important to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...