Compound Q&A

What are the physical and chemical properties of Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5)?

Answer

Fmoc-lys(ME,boc)-OH
Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5) is a solid crystalline compound with a molecular weight of approximately 555.44 g/mol. It is sparingly soluble in water but soluble in common organic solvents like DMF and DMSO. This compound is known for its reactivity in peptide coupling reactions and has a pKa around 8.0. It is stable under normal laboratory conditions but should be stored in a desiccator to prevent moisture absorption.

About

English Name Fmoc-lys(ME,boc)-OH
Molecular Formula C27H34N2O6
Molecular Weight 482.58 g/mol
SMILES CC(C)(C)OC(=O)N(C)CCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey JHMSFOFHTAYQLS-QHCPKHFHSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5) typically synthesized?

Fmoc-lys(ME,boc)-OH is typically synthesized through a multi-step process involving the protection o...

Compound Q&A

What industries use Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5)?

Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5) is primarily used in the pharmaceutical and biotechnology ind...

Compound Q&A

What precautions should be taken when handling Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5)?

When handling Fmoc-lys(ME,boc)-OH (CAS: 951695-85-5), it is important to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...