Compound Q&A

What precautions should be taken when handling Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Answer

Pentadecafluorooctanoyl chloride
Handling Pentadecafluorooctanoyl chloride requires rigorous safety measures. Always wear appropriate personal protective equipment (PPE), including gloves, safety glasses, and a lab coat. Work in a well-ventilated area or a fume hood to minimize exposure. Store the compound in a cool, dry place away from sources of heat and ignition. In case of a spill, immediately contain it and follow the manufacturer's safety data sheet (SDS) guidelines for disposal. Avoid contact with skin and eyes, and seek medical attention if exposure occurs.

About

CAS No 335-64-8
English Name Pentadecafluorooctanoyl chloride
Molecular Formula C8ClF15O
Molecular Weight 432.51 g/mol
SMILES C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl
InChIKey AQQBRCXWZZAFOK-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Pentadecafluorooctanoyl chloride is a colorless liquid with a molecular weight of approximately 422....

Compound Q&A

How is Pentadecafluorooctanoyl chloride (CAS: 335-64-8) typically synthesized?

Pentadecafluorooctanoyl chloride is usually synthesized by reacting pentadecafluoro-2-dodecanol with...

Compound Q&A

What industries use Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Pentadecafluorooctanoyl chloride finds applications in various industries, including pharmaceuticals...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...