Compound Q&A

How is Pentadecafluorooctanoyl chloride (CAS: 335-64-8) typically synthesized?

Answer

Pentadecafluorooctanoyl chloride
Pentadecafluorooctanoyl chloride is usually synthesized by reacting pentadecafluoro-2-dodecanol with thionyl chloride in the presence of a suitable catalyst, such as aluminum chloride. The reaction is conducted in an inert atmosphere to prevent oxidation of the fluorinated alcohol. The yield is typically high, and the selectivity towards the desired product is good. The process requires careful handling due to the reactivity and volatility of the starting materials.

About

CAS No 335-64-8
English Name Pentadecafluorooctanoyl chloride
Molecular Formula C8ClF15O
Molecular Weight 432.51 g/mol
SMILES C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl
InChIKey AQQBRCXWZZAFOK-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Pentadecafluorooctanoyl chloride is a colorless liquid with a molecular weight of approximately 422....

Compound Q&A

What industries use Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Pentadecafluorooctanoyl chloride finds applications in various industries, including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Handling Pentadecafluorooctanoyl chloride requires rigorous safety measures. Always wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...