Compound Q&A

What industries use Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Answer

Pentadecafluorooctanoyl chloride
Pentadecafluorooctanoyl chloride finds applications in various industries, including pharmaceuticals, where it is used as a building block for fluorinated compounds with specific biological properties. It is also used in the polymer industry to introduce fluorinated side chains, enhancing the chemical stability and hydrophobicity of materials. Additionally, it is utilized in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 335-64-8
English Name Pentadecafluorooctanoyl chloride
Molecular Formula C8ClF15O
Molecular Weight 432.51 g/mol
SMILES C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl
InChIKey AQQBRCXWZZAFOK-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Pentadecafluorooctanoyl chloride is a colorless liquid with a molecular weight of approximately 422....

Compound Q&A

How is Pentadecafluorooctanoyl chloride (CAS: 335-64-8) typically synthesized?

Pentadecafluorooctanoyl chloride is usually synthesized by reacting pentadecafluoro-2-dodecanol with...

Compound Q&A

What precautions should be taken when handling Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Handling Pentadecafluorooctanoyl chloride requires rigorous safety measures. Always wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...