Compound Q&A

What are the physical and chemical properties of Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Answer

Pentadecafluorooctanoyl chloride
Pentadecafluorooctanoyl chloride is a colorless liquid with a molecular weight of approximately 422.45. It has a low vapor pressure and is only slightly soluble in water. The compound exhibits high reactivity, especially towards nucleophiles, due to its electrophilic fluorinated acyl chloride moiety. It is typically used in organic synthesis and as a functional group in fluorinated materials. Its physical state is solid at room temperature, with a melting point around -40°C and a boiling point around 120°C.

About

CAS No 335-64-8
English Name Pentadecafluorooctanoyl chloride
Molecular Formula C8ClF15O
Molecular Weight 432.51 g/mol
SMILES C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl
InChIKey AQQBRCXWZZAFOK-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is Pentadecafluorooctanoyl chloride (CAS: 335-64-8) typically synthesized?

Pentadecafluorooctanoyl chloride is usually synthesized by reacting pentadecafluoro-2-dodecanol with...

Compound Q&A

What industries use Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Pentadecafluorooctanoyl chloride finds applications in various industries, including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling Pentadecafluorooctanoyl chloride (CAS: 335-64-8)?

Handling Pentadecafluorooctanoyl chloride requires rigorous safety measures. Always wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...