Compound Q&A

What industries use 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7)?

Answer

4-Methyl-2-benzofuran-1,3-dione
4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) is utilized in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of certain drugs. It is also used in the production of polymers, sensors, and semiconductors due to its unique chemical properties and reactivity. Its applications in these industries leverage its ability to form stable compounds and its reactivity towards various functional groups.

About

CAS No 4792-30-7
English Name 4-Methyl-2-benzofuran-1,3-dione
Molecular Formula C9H6O3
Molecular Weight 162.14399999999998 g/mol
SMILES CC1=C2C(=CC=C1)C(=O)OC2=O
InChIKey TWWAWPHAOPTQEU-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7)?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through several methods, includi...

Compound Q&A

What precautions should be taken when handling 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7)?

When handling 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7), it is essential to use appropriate p...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...