Compound Q&A

What are the physical and chemical properties of 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7)?

Answer

4-Methyl-2-benzofuran-1,3-dione
4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) is a crystalline solid with a molecular weight of approximately 194.16 g/mol. It has a melting point of around 160-162°C and is poorly soluble in water but soluble in organic solvents such as methanol and acetone. The compound is known for its good reactivity, particularly towards nucleophiles and electrophiles, making it useful in various chemical reactions and transformations.

About

CAS No 4792-30-7
English Name 4-Methyl-2-benzofuran-1,3-dione
Molecular Formula C9H6O3
Molecular Weight 162.14399999999998 g/mol
SMILES CC1=C2C(=CC=C1)C(=O)OC2=O
InChIKey TWWAWPHAOPTQEU-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through several methods, includi...

Compound Q&A

What industries use 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7)?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) is utilized in various industries, including pharma...

Compound Q&A

What precautions should be taken when handling 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7)?

When handling 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7), it is essential to use appropriate p...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...