Compound Q&A

What industries use (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8)?

Answer

(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid
(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) is used in various industries, including pharmaceuticals and drug discovery where it serves as a building block for synthesizing more complex molecules. It is also utilized in the polymer industry for developing new materials with specific properties. Additionally, this compound may find applications in the sensor technology sector for detecting specific chemical compounds, and in the semiconductor industry for its potential use in the fabrication of thin films and coatings.

About

CAS No 28697-17-8
English Name (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid
Molecular Formula C11H19NO4
Molecular Weight 229.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C(=O)O
InChIKey JQAOHGMPAAWWQO-MRVPVSSYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8)?

(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) is a white...

Compound Q&A

How is (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) typically synthesized?

(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) is typical...

Compound Q&A

What precautions should be taken when handling (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8)?

When handling (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...