Compound Q&A

How is (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) typically synthesized?

Answer

(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid
(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) is typically synthesized through a multi-step process involving the formation of a piperidine ring followed by acylation. Common methods include the use of acyl chlorides or carboxylic acids with piperidine derivatives. The reaction is typically carried out in anhydrous conditions using a suitable solvent like dichloromethane, and the use of a catalytic amount of a base like triethylamine can enhance the yield and selectivity.

About

CAS No 28697-17-8
English Name (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid
Molecular Formula C11H19NO4
Molecular Weight 229.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C(=O)O
InChIKey JQAOHGMPAAWWQO-MRVPVSSYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8)?

(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) is a white...

Compound Q&A

What industries use (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8)?

(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) is used in...

Compound Q&A

What precautions should be taken when handling (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8)?

When handling (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...