Compound Q&A

What are the physical and chemical properties of (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8)?

Answer

(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid
(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) is a white crystalline solid with a molecular weight of approximately 238.37 g/mol. It has a high solubility in organic solvents such as methanol and ethanol but is only slightly soluble in water. Reactivity is moderate, and it can participate in amide formation and esterification reactions. The compound is known for its stability under normal conditions, but care should be taken to avoid strong acids and bases that can alter its structure.

About

CAS No 28697-17-8
English Name (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid
Molecular Formula C11H19NO4
Molecular Weight 229.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C(=O)O
InChIKey JQAOHGMPAAWWQO-MRVPVSSYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) typically synthesized?

(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) is typical...

Compound Q&A

What industries use (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8)?

(2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8) is used in...

Compound Q&A

What precautions should be taken when handling (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17-8)?

When handling (2R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 28697-17...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...