Compound Q&A

What industries use 8-Quinolinecarbaldehyde (CAS: 38707-70-9)?

Answer

8-Quinolinecarbaldehyde
8-Quinolinecarbaldehyde (CAS: 38707-70-9) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those requiring specific substituents on quinoline rings. It is also employed in the polymer industry to improve the properties of certain polymers. Additionally, this compound has applications in the development of sensors and semiconductors due to its unique optical and electronic properties.

About

CAS No 38707-70-9
English Name 8-Quinolinecarbaldehyde
Molecular Formula C10H7NO
Molecular Weight 157.17 g/mol
SMILES C1=CC2=C(C(=C1)C=O)N=CC=C2
InChIKey OVZQVGZERAFSPI-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Quinolinecarbaldehyde (CAS: 38707-70-9)?

8-Quinolinecarbaldehyde (CAS: 38707-70-9) is a yellow solid with a molecular weight of approximately...

Compound Q&A

How is 8-Quinolinecarbaldehyde (CAS: 38707-70-9) typically synthesized?

8-Quinolinecarbaldehyde can be synthesized via the reduction of 8-quinolinecarboxylic acid using sod...

Compound Q&A

What precautions should be taken when handling 8-Quinolinecarbaldehyde (CAS: 38707-70-9)?

When handling 8-Quinolinecarbaldehyde (CAS: 38707-70-9), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...