Compound Q&A

How is 8-Quinolinecarbaldehyde (CAS: 38707-70-9) typically synthesized?

Answer

8-Quinolinecarbaldehyde
8-Quinolinecarbaldehyde can be synthesized via the reduction of 8-quinolinecarboxylic acid using sodium borohydride or similar reducing agents. Another method involves the alkylation of 8-quinolone with formaldehyde followed by hydrolysis. The reaction conditions, such as temperature and catalysts, can vary, but the overall yield is typically around 70-80%. This compound is also prepared through condensation reactions involving quinoline derivatives and aldehydes.

About

CAS No 38707-70-9
English Name 8-Quinolinecarbaldehyde
Molecular Formula C10H7NO
Molecular Weight 157.17 g/mol
SMILES C1=CC2=C(C(=C1)C=O)N=CC=C2
InChIKey OVZQVGZERAFSPI-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Quinolinecarbaldehyde (CAS: 38707-70-9)?

8-Quinolinecarbaldehyde (CAS: 38707-70-9) is a yellow solid with a molecular weight of approximately...

Compound Q&A

What industries use 8-Quinolinecarbaldehyde (CAS: 38707-70-9)?

8-Quinolinecarbaldehyde (CAS: 38707-70-9) is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 8-Quinolinecarbaldehyde (CAS: 38707-70-9)?

When handling 8-Quinolinecarbaldehyde (CAS: 38707-70-9), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...