Compound Q&A

What are the physical and chemical properties of 8-Quinolinecarbaldehyde (CAS: 38707-70-9)?

Answer

8-Quinolinecarbaldehyde
8-Quinolinecarbaldehyde (CAS: 38707-70-9) is a yellow solid with a molecular weight of approximately 169.17 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. It is moderately reactive and susceptible to hydrolysis under basic conditions. This compound is known for its ability to form complexes with various metal ions and exhibits significant electrophilic aromatic substitution reactivity.

About

CAS No 38707-70-9
English Name 8-Quinolinecarbaldehyde
Molecular Formula C10H7NO
Molecular Weight 157.17 g/mol
SMILES C1=CC2=C(C(=C1)C=O)N=CC=C2
InChIKey OVZQVGZERAFSPI-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 8-Quinolinecarbaldehyde (CAS: 38707-70-9) typically synthesized?

8-Quinolinecarbaldehyde can be synthesized via the reduction of 8-quinolinecarboxylic acid using sod...

Compound Q&A

What industries use 8-Quinolinecarbaldehyde (CAS: 38707-70-9)?

8-Quinolinecarbaldehyde (CAS: 38707-70-9) is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 8-Quinolinecarbaldehyde (CAS: 38707-70-9)?

When handling 8-Quinolinecarbaldehyde (CAS: 38707-70-9), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...