Compound Q&A

What precautions should be taken when handling Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (CAS: 765935-67-9)?

Answer

Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (1:1)
Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn when handling this compound. It should be stored in a fume hood to minimize inhalation risks. Spills should be immediately cleaned up using appropriate absorbent materials. Safety data sheets (SDS) should be consulted for detailed handling and emergency procedures.

About

English Name Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (1:1)
Molecular Formula C15H19ClN2O3
Molecular Weight 310.78 g/mol
SMILES CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N3CCNCC3.Cl
InChIKey IQUHEEPSXHVIPO-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (CAS: 765935-67-9)?

Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride is a crystalline compound with a mo...

Compound Q&A

How is Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (CAS: 765935-67-9) typically synthesized?

Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride is typically synthesized via a mult...

Compound Q&A

What industries use Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (CAS: 765935-67-9)?

Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride is primarily used in the pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...