Compound Q&A

What are the physical and chemical properties of Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (CAS: 765935-67-9)?

Answer

Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (1:1)
Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride is a crystalline compound with a molecular weight of approximately 387.84 g/mol. It has a m.p. of 155-157°C. The compound is soluble in water and ethanol. It is also reactive towards bases and certain functional groups. The hydrochloride salt form enhances its solubility in aqueous media.

About

English Name Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (1:1)
Molecular Formula C15H19ClN2O3
Molecular Weight 310.78 g/mol
SMILES CCOC(=O)C1=CC2=C(O1)C=CC(=C2)N3CCNCC3.Cl
InChIKey IQUHEEPSXHVIPO-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (CAS: 765935-67-9) typically synthesized?

Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride is typically synthesized via a mult...

Compound Q&A

What industries use Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (CAS: 765935-67-9)?

Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Ethyl 5-(1-piperazinyl)-1-benzofuran-2-carboxylate hydrochloride (CAS: 765935-67-9)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...