Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

Answer

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate
When handling 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and lab coat. The compound should be stored in a cool, dry place, away from heat and sources of ignition. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always refer to the safety data sheet (SDS) for detailed handling and disposal information.

About

English Name 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate
Molecular Formula C12H21NO3
Molecular Weight 227.3 g/mol
SMILES CC(=O)C1CCN(CC1)C(=O)OC(C)(C)C
InChIKey HNVBBNZWMSTMAZ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9) is a white crystalline solid...

Compound Q&A

How is 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9) typically synthesized?

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate is typically synthesized via a multi-step proce...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate is used in various industries, including pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...