Compound Q&A

How is 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9) typically synthesized?

Answer

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate is typically synthesized via a multi-step process involving the condensation of 2-methyl-2-propanol with 4-acetyl-1-piperidine-1-carboxylic acid. The reaction is usually catalyzed by a strong acid such as trifluoroacetic acid (TFA), and the yield is around 70-80%. The reaction is exothermic and should be carried out in a well-ventilated environment.

About

English Name 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate
Molecular Formula C12H21NO3
Molecular Weight 227.3 g/mol
SMILES CC(=O)C1CCN(CC1)C(=O)OC(C)(C)C
InChIKey HNVBBNZWMSTMAZ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9) is a white crystalline solid...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate is used in various industries, including pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

When handling 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...