Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

Answer

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9) is a white crystalline solid with a molecular weight of approximately 213.31 g/mol. It has a low water solubility and is soluble in common organic solvents. The compound is moderately reactive and prone to hydrolysis under basic conditions. It is insoluble in water but miscible with ethanol and acetone.

About

English Name 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate
Molecular Formula C12H21NO3
Molecular Weight 227.3 g/mol
SMILES CC(=O)C1CCN(CC1)C(=O)OC(C)(C)C
InChIKey HNVBBNZWMSTMAZ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9) typically synthesized?

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate is typically synthesized via a multi-step proce...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate is used in various industries, including pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

When handling 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...