Compound Q&A

What industries use 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

Answer

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate is used in various industries, including pharmaceuticals, where it can serve as an intermediate in the synthesis of active pharmaceutical ingredients (APIs). It also finds applications in the polymer industry as a monomer for the production of certain polymeric materials. Additionally, it is used in the development of sensors and semiconductors due to its chemical properties.

About

English Name 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate
Molecular Formula C12H21NO3
Molecular Weight 227.3 g/mol
SMILES CC(=O)C1CCN(CC1)C(=O)OC(C)(C)C
InChIKey HNVBBNZWMSTMAZ-UHFFFAOYSA-N
Last Updated: 2025-09-29 09:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9) is a white crystalline solid...

Compound Q&A

How is 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9) typically synthesized?

2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate is typically synthesized via a multi-step proce...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9)?

When handling 2-Methyl-2-propanyl 4-acetyl-1-piperidinecarboxylate (CAS: 206989-61-9), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...