Compound Q&A

What precautions should be taken when handling 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

Answer

4-Fluoro-3-methoxyphenylboronic acid
When handling 4-Fluoro-3-methoxyphenylboronic acid, it is essential to take appropriate safety precautions. It should be handled in a well-ventilated fume hood to avoid inhalation. Personal protective equipment (PPE) such as gloves, goggles, and lab coats is necessary. Spills should be cleaned up immediately using appropriate absorbents. It is recommended to consult the Safety Data Sheet (SDS) for detailed handling and disposal information. If contact with skin or eyes occurs, immediate washing with copious amounts of water is advised, and medical attention should be sought if necessary.

About

English Name 4-Fluoro-3-methoxyphenylboronic acid
Molecular Formula C7H8BFO3
Molecular Weight 169.948 g/mol
SMILES B(C1=CC(=C(C=C1)F)OC)(O)O
InChIKey LUJMSRVFSBMEOY-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

4-Fluoro-3-methoxyphenylboronic acid is a solid compound with a crystalline form. Its molecular weig...

Compound Q&A

How is 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7) typically synthesized?

4-Fluoro-3-methoxyphenylboronic acid is typically synthesized through a Suzuki-Miyaura cross-couplin...

Compound Q&A

What industries use 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

4-Fluoro-3-methoxyphenylboronic acid is used in various industries due to its reactivity and utility...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...