Compound Q&A

What are the physical and chemical properties of 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

Answer

4-Fluoro-3-methoxyphenylboronic acid
4-Fluoro-3-methoxyphenylboronic acid is a solid compound with a crystalline form. Its molecular weight is approximately 218.13 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. It is reactive towards nucleophiles and can participate in boronate ester formation. It is stable under normal laboratory conditions but should be stored in a cool, dry place away from moisture and oxidizing agents.

About

English Name 4-Fluoro-3-methoxyphenylboronic acid
Molecular Formula C7H8BFO3
Molecular Weight 169.948 g/mol
SMILES B(C1=CC(=C(C=C1)F)OC)(O)O
InChIKey LUJMSRVFSBMEOY-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7) typically synthesized?

4-Fluoro-3-methoxyphenylboronic acid is typically synthesized through a Suzuki-Miyaura cross-couplin...

Compound Q&A

What industries use 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

4-Fluoro-3-methoxyphenylboronic acid is used in various industries due to its reactivity and utility...

Compound Q&A

What precautions should be taken when handling 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

When handling 4-Fluoro-3-methoxyphenylboronic acid, it is essential to take appropriate safety preca...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...