Compound Q&A

What industries use 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

Answer

4-Fluoro-3-methoxyphenylboronic acid
4-Fluoro-3-methoxyphenylboronic acid is used in various industries due to its reactivity and utility in organic synthesis. It is primarily used in the pharmaceutical industry for the preparation of drug intermediates. It is also used in the polymer industry for the synthesis of advanced polymers, in the semiconductor industry for the fabrication of electronic materials, and in the sensor industry for the development of chemical sensors.

About

English Name 4-Fluoro-3-methoxyphenylboronic acid
Molecular Formula C7H8BFO3
Molecular Weight 169.948 g/mol
SMILES B(C1=CC(=C(C=C1)F)OC)(O)O
InChIKey LUJMSRVFSBMEOY-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

4-Fluoro-3-methoxyphenylboronic acid is a solid compound with a crystalline form. Its molecular weig...

Compound Q&A

How is 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7) typically synthesized?

4-Fluoro-3-methoxyphenylboronic acid is typically synthesized through a Suzuki-Miyaura cross-couplin...

Compound Q&A

What precautions should be taken when handling 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

When handling 4-Fluoro-3-methoxyphenylboronic acid, it is essential to take appropriate safety preca...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...