Compound Q&A

How is 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7) typically synthesized?

Answer

4-Fluoro-3-methoxyphenylboronic acid
4-Fluoro-3-methoxyphenylboronic acid is typically synthesized through a Suzuki-Miyaura cross-coupling reaction. The synthesis involves the reaction of 4-fluoro-3-methoxybenzyl bromide with phenylboronic acid in the presence of a palladium catalyst, such as palladium(II) acetate, and a base like sodium carbonate. The reaction is usually carried out in an organic solvent like toluene or dimethylformamide. The yield is generally high, and the reaction is known for its high regioselectivity and chemoselectivity.

About

English Name 4-Fluoro-3-methoxyphenylboronic acid
Molecular Formula C7H8BFO3
Molecular Weight 169.948 g/mol
SMILES B(C1=CC(=C(C=C1)F)OC)(O)O
InChIKey LUJMSRVFSBMEOY-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

4-Fluoro-3-methoxyphenylboronic acid is a solid compound with a crystalline form. Its molecular weig...

Compound Q&A

What industries use 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

4-Fluoro-3-methoxyphenylboronic acid is used in various industries due to its reactivity and utility...

Compound Q&A

What precautions should be taken when handling 4-Fluoro-3-methoxyphenylboronic acid (CAS: 854778-31-7)?

When handling 4-Fluoro-3-methoxyphenylboronic acid, it is essential to take appropriate safety preca...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...