Compound Q&A

How should waste containing Aloin B (CAS: 28371-16-6) be handled?

Answer

Aloin B
Waste containing Aloin B (CAS: 28371-16-6) should be collected in appropriate containers and disposed of according to local regulations. Incineration or professional waste disposal methods are recommended to ensure environmental safety. Proper labeling and documentation of waste management practices are essential.

About

CAS No 28371-16-6
English Name Aloin B
Molecular Formula C21H22O9
Molecular Weight 418.4 g/mol
SMILES OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)[C@@H]1C2=CC=CC(O)=C2C(=O)C2=C(O)C=C(CO)C=C12
InChIKey AFHJQYHRLPMKHU-WEZNYRQKSA-N
Last Updated: 2025-09-27 00:43

Related Q&A

Compound Q&A

What regulatory guidelines apply to Aloin B (CAS: 28371-16-6)?

Aloin B (CAS: 28371-16-6) is regulated under various guidelines such as the Globally Harmonized Syst...

Compound Q&A

Are there alternatives to Aloin B in synthesis (CAS: 28371-16-6)?

While Aloin B (CAS: 28371-16-6) is a specific compound, alternatives like emodin or other anthraquin...

Compound Q&A

What is the market or research trend for Aloin B (CAS: 28371-16-6)?

The research trend for Aloin B (CAS: 28371-16-6) is focused on its potential as a natural antioxidan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...