Compound Q&A

What is the market or research trend for Aloin B (CAS: 28371-16-6)?

Answer

Aloin B
The research trend for Aloin B (CAS: 28371-16-6) is focused on its potential as a natural antioxidant and anti-inflammatory agent. Market trends indicate increasing interest in natural compounds for pharmaceutical and cosmeceutical applications. Emerging studies are exploring its use in topical and oral formulations.

About

CAS No 28371-16-6
English Name Aloin B
Molecular Formula C21H22O9
Molecular Weight 418.4 g/mol
SMILES OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)[C@@H]1C2=CC=CC(O)=C2C(=O)C2=C(O)C=C(CO)C=C12
InChIKey AFHJQYHRLPMKHU-WEZNYRQKSA-N
Last Updated: 2025-09-27 00:43

Related Q&A

Compound Q&A

What regulatory guidelines apply to Aloin B (CAS: 28371-16-6)?

Aloin B (CAS: 28371-16-6) is regulated under various guidelines such as the Globally Harmonized Syst...

Compound Q&A

Are there alternatives to Aloin B in synthesis (CAS: 28371-16-6)?

While Aloin B (CAS: 28371-16-6) is a specific compound, alternatives like emodin or other anthraquin...

Compound Q&A

How should waste containing Aloin B (CAS: 28371-16-6) be handled?

Waste containing Aloin B (CAS: 28371-16-6) should be collected in appropriate containers and dispose...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...