Compound Q&A

Are there alternatives to Aloin B in synthesis (CAS: 28371-16-6)?

Answer

Aloin B
While Aloin B (CAS: 28371-16-6) is a specific compound, alternatives like emodin or other anthraquinones can be used in similar synthetic pathways. These alternatives can offer similar properties and are often chosen based on availability and cost.

About

CAS No 28371-16-6
English Name Aloin B
Molecular Formula C21H22O9
Molecular Weight 418.4 g/mol
SMILES OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)[C@@H]1C2=CC=CC(O)=C2C(=O)C2=C(O)C=C(CO)C=C12
InChIKey AFHJQYHRLPMKHU-WEZNYRQKSA-N
Last Updated: 2025-09-27 00:43

Related Q&A

Compound Q&A

What regulatory guidelines apply to Aloin B (CAS: 28371-16-6)?

Aloin B (CAS: 28371-16-6) is regulated under various guidelines such as the Globally Harmonized Syst...

Compound Q&A

What is the market or research trend for Aloin B (CAS: 28371-16-6)?

The research trend for Aloin B (CAS: 28371-16-6) is focused on its potential as a natural antioxidan...

Compound Q&A

How should waste containing Aloin B (CAS: 28371-16-6) be handled?

Waste containing Aloin B (CAS: 28371-16-6) should be collected in appropriate containers and dispose...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...