Compound Q&A

What regulatory guidelines apply to Aloin B (CAS: 28371-16-6)?

Answer

Aloin B
Aloin B (CAS: 28371-16-6) is regulated under various guidelines such as the Globally Harmonized System (GHS) for Classification and Labeling of Chemicals, REACH regulations in the European Union, and FDA and EPA requirements for biocides and fungicides. It is important to adhere to these guidelines for safe handling and storage.

About

CAS No 28371-16-6
English Name Aloin B
Molecular Formula C21H22O9
Molecular Weight 418.4 g/mol
SMILES OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)[C@@H]1C2=CC=CC(O)=C2C(=O)C2=C(O)C=C(CO)C=C12
InChIKey AFHJQYHRLPMKHU-WEZNYRQKSA-N
Last Updated: 2025-09-27 00:43

Related Q&A

Compound Q&A

Are there alternatives to Aloin B in synthesis (CAS: 28371-16-6)?

While Aloin B (CAS: 28371-16-6) is a specific compound, alternatives like emodin or other anthraquin...

Compound Q&A

What is the market or research trend for Aloin B (CAS: 28371-16-6)?

The research trend for Aloin B (CAS: 28371-16-6) is focused on its potential as a natural antioxidan...

Compound Q&A

How should waste containing Aloin B (CAS: 28371-16-6) be handled?

Waste containing Aloin B (CAS: 28371-16-6) should be collected in appropriate containers and dispose...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...