Compound Q&A

What industries use N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

Answer

N-(4-Nitrophenyl)acetamide
N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also used in the polymer industry for the production of special resins and adhesives. Additionally, it is used in the development of sensors and semiconductors.

About

CAS No 104-04-1
English Name N-(4-Nitrophenyl)acetamide
Molecular Formula C8H8N2O3
Molecular Weight 180.16 g/mol
SMILES CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-]
InChIKey NQRLPDFELNCFHW-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) is a white crystalline solid with a molecular weight of a...

Compound Q&A

How is N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) typically synthesized?

N-(4-Nitrophenyl)acetamide is typically synthesized by the acetylation of 4-nitrophenol using acetic...

Compound Q&A

What precautions should be taken when handling N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

When handling N-(4-Nitrophenyl)acetamide (CAS: 104-04-1), use appropriate personal protective equipm...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...