Compound Q&A

What industries use N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

Answer

N-(4-Nitrophenyl)acetamide
N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also used in the polymer industry for the production of special resins and adhesives. Additionally, it is used in the development of sensors and semiconductors.

About

CAS No 104-04-1
English Name N-(4-Nitrophenyl)acetamide
Molecular Formula C8H8N2O3
Molecular Weight 180.16 g/mol
SMILES CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-]
InChIKey NQRLPDFELNCFHW-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) is a white crystalline solid with a molecular weight of a...

Compound Q&A

How is N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) typically synthesized?

N-(4-Nitrophenyl)acetamide is typically synthesized by the acetylation of 4-nitrophenol using acetic...

Compound Q&A

What precautions should be taken when handling N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

When handling N-(4-Nitrophenyl)acetamide (CAS: 104-04-1), use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...