Compound Q&A

What are the physical and chemical properties of N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

Answer

N-(4-Nitrophenyl)acetamide
N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) is a white crystalline solid with a molecular weight of approximately 191.13 g/mol. It has a melting point of 122-124°C and is slightly soluble in water. It is stable under normal conditions but can react with strong bases to form 4-nitrophenol. It is also known to be sensitive to light and heat.

About

CAS No 104-04-1
English Name N-(4-Nitrophenyl)acetamide
Molecular Formula C8H8N2O3
Molecular Weight 180.16 g/mol
SMILES CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-]
InChIKey NQRLPDFELNCFHW-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) typically synthesized?

N-(4-Nitrophenyl)acetamide is typically synthesized by the acetylation of 4-nitrophenol using acetic...

Compound Q&A

What industries use N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) is primarily used in the pharmaceutical industry as an in...

Compound Q&A

What precautions should be taken when handling N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

When handling N-(4-Nitrophenyl)acetamide (CAS: 104-04-1), use appropriate personal protective equipm...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...