Compound Q&A

How is N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) typically synthesized?

Answer

N-(4-Nitrophenyl)acetamide
N-(4-Nitrophenyl)acetamide is typically synthesized by the acetylation of 4-nitrophenol using acetic anhydride in the presence of a catalyst such as pyridine. The reaction is carried out at room temperature, and the yield is generally around 85-90%. The product is then purified by recrystallization.

About

CAS No 104-04-1
English Name N-(4-Nitrophenyl)acetamide
Molecular Formula C8H8N2O3
Molecular Weight 180.16 g/mol
SMILES CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-]
InChIKey NQRLPDFELNCFHW-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) is a white crystalline solid with a molecular weight of a...

Compound Q&A

What industries use N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

N-(4-Nitrophenyl)acetamide (CAS: 104-04-1) is primarily used in the pharmaceutical industry as an in...

Compound Q&A

What precautions should be taken when handling N-(4-Nitrophenyl)acetamide (CAS: 104-04-1)?

When handling N-(4-Nitrophenyl)acetamide (CAS: 104-04-1), use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...