Compound Q&A

What precautions should be taken when handling tetramethylazanium nitrate (CAS: 1941-24-8)?

Answer

tetramethylazanium nitrate
When handling tetramethylazanium nitrate (CAS: 1941-24-8), it is crucial to follow standard laboratory safety guidelines. Wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Store it in a cool, dry place away from heat and ignition sources. In case of spill, use appropriate absorbents and follow local safety regulations for disposal. Refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

CAS No 1941-24-8
English Name tetramethylazanium nitrate
Molecular Formula C4H12N2O3
Molecular Weight 136.15 g/mol
SMILES C[N+](C)(C)C.[N+](=O)([O-])[O-]
InChIKey QGPVYHSXZFOSRL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of tetramethylazanium nitrate (CAS: 1941-24-8)?

Tetramethylazanium nitrate (CAS: 1941-24-8) is a colorless to slightly yellow liquid with a molecula...

Compound Q&A

How is tetramethylazanium nitrate (CAS: 1941-24-8) typically synthesized?

Tetramethylazanium nitrate (CAS: 1941-24-8) is commonly synthesized by the reaction of nitric acid w...

Compound Q&A

What industries use tetramethylazanium nitrate (CAS: 1941-24-8)?

Tetramethylazanium nitrate (CAS: 1941-24-8) is utilized in various industries, including pharmaceuti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...