Compound Q&A

What are the physical and chemical properties of tetramethylazanium nitrate (CAS: 1941-24-8)?

Answer

tetramethylazanium nitrate
Tetramethylazanium nitrate (CAS: 1941-24-8) is a colorless to slightly yellow liquid with a molecular weight of approximately 149.13 g/mol. It is soluble in water and ethanol, and exhibits good stability under normal conditions. It can react readily with strong acids and bases, and forms explosive mixtures with organic materials.

About

CAS No 1941-24-8
English Name tetramethylazanium nitrate
Molecular Formula C4H12N2O3
Molecular Weight 136.15 g/mol
SMILES C[N+](C)(C)C.[N+](=O)([O-])[O-]
InChIKey QGPVYHSXZFOSRL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is tetramethylazanium nitrate (CAS: 1941-24-8) typically synthesized?

Tetramethylazanium nitrate (CAS: 1941-24-8) is commonly synthesized by the reaction of nitric acid w...

Compound Q&A

What industries use tetramethylazanium nitrate (CAS: 1941-24-8)?

Tetramethylazanium nitrate (CAS: 1941-24-8) is utilized in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling tetramethylazanium nitrate (CAS: 1941-24-8)?

When handling tetramethylazanium nitrate (CAS: 1941-24-8), it is crucial to follow standard laborato...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...